C9H12ClF2NO — CID 141001836
1-(2,5-difluorophenoxy)propan-1-amine;hydrochloride (PubChem CID 141001836) has the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. Its IUPAC name is 1-(2,5-difluorophenoxy)propan-1-amine;hydrochloride.
| Compound Name | 1-(2,5-difluorophenoxy)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 141001836 |
| Molecular Formula | C9H12ClF2NO |
| Molecular Weight | 223.65 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-(2,5-difluorophenoxy)propan-1-amine;hydrochloride |
| SMILES | CCC(N)Oc1cc(F)ccc1F.Cl |
| InChI | InChI=1S/C9H11F2NO.ClH/c1-2-9(12)13-8-5-6(10)3-4-7(8)11;/h3-5,9H,2,12H2,1H3;1H |
| InChIKey | ATZGOWBRBYBYBI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|