C13H17F2NO2 — CID 95973725
(2S)-N-butyl-2-(2,5-difluorophenoxy)propanamide (PubChem CID 95973725) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is (2S)-N-butyl-2-(2,5-difluorophenoxy)propanamide.
| Compound Name | (2S)-N-butyl-2-(2,5-difluorophenoxy)propanamide |
|---|---|
| PubChem CID | 95973725 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-N-butyl-2-(2,5-difluorophenoxy)propanamide |
| SMILES | CCCCNC(=O)[C@H](C)Oc1cc(F)ccc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-3-4-7-16-13(17)9(2)18-12-8-10(14)5-6-11(12)15/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | GWTXNZNJSDANGD-VIFPVBQESA-N |
| XLogP | 2.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|