C14H17FN2O2 — CID 103792212
N-butyl-2-(4-cyano-2-fluorophenoxy)propanamide (PubChem CID 103792212) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is N-butyl-2-(4-cyano-2-fluorophenoxy)propanamide.
| Compound Name | N-butyl-2-(4-cyano-2-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 103792212 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-butyl-2-(4-cyano-2-fluorophenoxy)propanamide |
| SMILES | CCCCNC(=O)C(C)Oc1ccc(C#N)cc1F |
| InChI | InChI=1S/C14H17FN2O2/c1-3-4-7-17-14(18)10(2)19-13-6-5-11(9-16)8-12(13)15/h5-6,8,10H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | CRURYEXQHFIXGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|