C13H19F2NO — CID 55169271
5-(2,5-difluorophenoxy)-N-ethylpentan-2-amine (PubChem CID 55169271) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 5-(2,5-difluorophenoxy)-N-ethylpentan-2-amine.
| Compound Name | 5-(2,5-difluorophenoxy)-N-ethylpentan-2-amine |
|---|---|
| PubChem CID | 55169271 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-(2,5-difluorophenoxy)-N-ethylpentan-2-amine |
| SMILES | CCNC(C)CCCOc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NO/c1-3-16-10(2)5-4-8-17-13-9-11(14)6-7-12(13)15/h6-7,9-10,16H,3-5,8H2,1-2H3 |
| InChIKey | OGIIXQPBDGVYAK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|