C12H17FO2 — CID 106802653
6-(3-fluorophenoxy)hexan-3-ol (PubChem CID 106802653) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 6-(3-fluorophenoxy)hexan-3-ol.
| Compound Name | 6-(3-fluorophenoxy)hexan-3-ol |
|---|---|
| PubChem CID | 106802653 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 6-(3-fluorophenoxy)hexan-3-ol |
| SMILES | CCC(O)CCCOc1cccc(F)c1 |
| InChI | InChI=1S/C12H17FO2/c1-2-11(14)6-4-8-15-12-7-3-5-10(13)9-12/h3,5,7,9,11,14H,2,4,6,8H2,1H3 |
| InChIKey | RPHYXFMOFBJVCS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|