C12H17FO — CID 64515590
6-(3-fluorophenyl)hexan-3-ol (PubChem CID 64515590) has the molecular formula C12H17FO and a molecular weight of 196.27 g/mol. Its IUPAC name is 6-(3-fluorophenyl)hexan-3-ol.
| Compound Name | 6-(3-fluorophenyl)hexan-3-ol |
|---|---|
| PubChem CID | 64515590 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 6-(3-fluorophenyl)hexan-3-ol |
| SMILES | CCC(O)CCCc1cccc(F)c1 |
| InChI | InChI=1S/C12H17FO/c1-2-12(14)8-4-6-10-5-3-7-11(13)9-10/h3,5,7,9,12,14H,2,4,6,8H2,1H3 |
| InChIKey | BNIPCVLDCUFZHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |