About acetylene;1-butyl-3-fluorobenzene
acetylene;1-butyl-3-fluorobenzene (PubChem CID 142913636) has the molecular formula C12H15F
and a molecular weight of 178.25 g/mol. Its IUPAC name is acetylene;1-butyl-3-fluorobenzene.
Molecular Properties
| Compound Name | acetylene;1-butyl-3-fluorobenzene |
| PubChem CID | 142913636 |
| Molecular Formula | C12H15F |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | acetylene;1-butyl-3-fluorobenzene |
| SMILES | C#C.CCCCc1cccc(F)c1 |
| InChI | InChI=1S/C10H13F.C2H2/c1-2-3-5-9-6-4-7-10(11)8-9;1-2/h4,6-8H,2-3,5H2,1H3;1-2H |
| InChIKey | HWFCYYIAYSUZFH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-butyl-3-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-butyl-3-fluorobenzene?
The IUPAC name of acetylene;1-butyl-3-fluorobenzene (CID 142913636) is acetylene;1-butyl-3-fluorobenzene.
What is the SMILES notation for acetylene;1-butyl-3-fluorobenzene?
The canonical SMILES for acetylene;1-butyl-3-fluorobenzene is C#C.CCCCc1cccc(F)c1.
What is the InChIKey of acetylene;1-butyl-3-fluorobenzene?
The InChIKey is HWFCYYIAYSUZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F.C2H2/c1-2-3-5-9-6-4-7-10(11)8-9;1-2/h4,6-8H,2-3,5H2,1H3;1-2H.
What are the key properties of acetylene;1-butyl-3-fluorobenzene?
acetylene;1-butyl-3-fluorobenzene has a molecular weight of 178.25 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-butyl-3-fluorobenzene is sourced from PubChem (CID 142913636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).