About 1,3-dipentylbenzene;fluorobenzene
1,3-dipentylbenzene;fluorobenzene (PubChem CID 174957175) has the molecular formula C22H31F
and a molecular weight of 314.49 g/mol. Its IUPAC name is 1,3-dipentylbenzene;fluorobenzene.
Molecular Properties
| Compound Name | 1,3-dipentylbenzene;fluorobenzene |
| PubChem CID | 174957175 |
| Molecular Formula | C22H31F |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1,3-dipentylbenzene;fluorobenzene |
| SMILES | CCCCCc1cccc(CCCCC)c1.Fc1ccccc1 |
| InChI | InChI=1S/C16H26.C6H5F/c1-3-5-7-10-15-12-9-13-16(14-15)11-8-6-4-2;7-6-4-2-1-3-5-6/h9,12-14H,3-8,10-11H2,1-2H3;1-5H |
| InChIKey | SKNJJKVTGNAWQM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipentylbenzene;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipentylbenzene;fluorobenzene?
The IUPAC name of 1,3-dipentylbenzene;fluorobenzene (CID 174957175) is 1,3-dipentylbenzene;fluorobenzene.
What is the SMILES notation for 1,3-dipentylbenzene;fluorobenzene?
The canonical SMILES for 1,3-dipentylbenzene;fluorobenzene is CCCCCc1cccc(CCCCC)c1.Fc1ccccc1.
What is the InChIKey of 1,3-dipentylbenzene;fluorobenzene?
The InChIKey is SKNJJKVTGNAWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26.C6H5F/c1-3-5-7-10-15-12-9-13-16(14-15)11-8-6-4-2;7-6-4-2-1-3-5-6/h9,12-14H,3-8,10-11H2,1-2H3;1-5H.
What are the key properties of 1,3-dipentylbenzene;fluorobenzene?
1,3-dipentylbenzene;fluorobenzene has a molecular weight of 314.49 g/mol, XLogP of 6.98, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipentylbenzene;fluorobenzene is sourced from PubChem (CID 174957175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).