About but-1-yne;1-fluoro-3-pentylbenzene
but-1-yne;1-fluoro-3-pentylbenzene (PubChem CID 174779976) has the molecular formula C15H21F
and a molecular weight of 220.33 g/mol. Its IUPAC name is but-1-yne;1-fluoro-3-pentylbenzene.
Molecular Properties
| Compound Name | but-1-yne;1-fluoro-3-pentylbenzene |
| PubChem CID | 174779976 |
| Molecular Formula | C15H21F |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | but-1-yne;1-fluoro-3-pentylbenzene |
| SMILES | C#CCC.CCCCCc1cccc(F)c1 |
| InChI | InChI=1S/C11H15F.C4H6/c1-2-3-4-6-10-7-5-8-11(12)9-10;1-3-4-2/h5,7-9H,2-4,6H2,1H3;1H,4H2,2H3 |
| InChIKey | RIAAFKOKHRSAMT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-yne;1-fluoro-3-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-yne;1-fluoro-3-pentylbenzene?
The IUPAC name of but-1-yne;1-fluoro-3-pentylbenzene (CID 174779976) is but-1-yne;1-fluoro-3-pentylbenzene.
What is the SMILES notation for but-1-yne;1-fluoro-3-pentylbenzene?
The canonical SMILES for but-1-yne;1-fluoro-3-pentylbenzene is C#CCC.CCCCCc1cccc(F)c1.
What is the InChIKey of but-1-yne;1-fluoro-3-pentylbenzene?
The InChIKey is RIAAFKOKHRSAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F.C4H6/c1-2-3-4-6-10-7-5-8-11(12)9-10;1-3-4-2/h5,7-9H,2-4,6H2,1H3;1H,4H2,2H3.
What are the key properties of but-1-yne;1-fluoro-3-pentylbenzene?
but-1-yne;1-fluoro-3-pentylbenzene has a molecular weight of 220.33 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-yne;1-fluoro-3-pentylbenzene is sourced from PubChem (CID 174779976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).