About 3-pentylaniline
3-pentylaniline (PubChem CID 19911390) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 3-pentylaniline.
Molecular Properties
| Compound Name | 3-pentylaniline |
| PubChem CID | 19911390 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 3-pentylaniline |
| SMILES | CCCCCc1cccc(N)c1 |
| InChI | InChI=1S/C11H17N/c1-2-3-4-6-10-7-5-8-11(12)9-10/h5,7-9H,2-4,6,12H2,1H3 |
| InChIKey | OGCDCBFCCFJKTK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-pentylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentylaniline?
The IUPAC name of 3-pentylaniline (CID 19911390) is 3-pentylaniline.
What is the SMILES notation for 3-pentylaniline?
The canonical SMILES for 3-pentylaniline is CCCCCc1cccc(N)c1.
What is the InChIKey of 3-pentylaniline?
The InChIKey is OGCDCBFCCFJKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-2-3-4-6-10-7-5-8-11(12)9-10/h5,7-9H,2-4,6,12H2,1H3.
What are the key properties of 3-pentylaniline?
3-pentylaniline has a molecular weight of 163.26 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentylaniline is sourced from PubChem (CID 19911390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).