C16H28N2 — CID 134222532
5-decylbenzene-1,3-diamine (PubChem CID 134222532) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 5-decylbenzene-1,3-diamine.
| Compound Name | 5-decylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 134222532 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 5-decylbenzene-1,3-diamine |
| SMILES | CCCCCCCCCCc1cc(N)cc(N)c1 |
| InChI | InChI=1S/C16H28N2/c1-2-3-4-5-6-7-8-9-10-14-11-15(17)13-16(18)12-14/h11-13H,2-10,17-18H2,1H3 |
| InChIKey | GOQREROXEIMQNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|