About 4-hexadecylaniline
4-hexadecylaniline (PubChem CID 571906) has the molecular formula C22H39N
and a molecular weight of 317.56 g/mol. Its IUPAC name is 4-hexadecylaniline.
Molecular Properties
| Compound Name | 4-hexadecylaniline |
| PubChem CID | 571906 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | 4-hexadecylaniline |
| SMILES | CCCCCCCCCCCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C22H39N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17-19-22(23)20-18-21/h17-20H,2-16,23H2,1H3 |
| InChIKey | RBCCQATUVPNPGQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-hexadecylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexadecylaniline?
The IUPAC name of 4-hexadecylaniline (CID 571906) is 4-hexadecylaniline.
What is the SMILES notation for 4-hexadecylaniline?
The canonical SMILES for 4-hexadecylaniline is CCCCCCCCCCCCCCCCc1ccc(N)cc1.
What is the InChIKey of 4-hexadecylaniline?
The InChIKey is RBCCQATUVPNPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17-19-22(23)20-18-21/h17-20H,2-16,23H2,1H3.
What are the key properties of 4-hexadecylaniline?
4-hexadecylaniline has a molecular weight of 317.56 g/mol, XLogP of 7.29, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexadecylaniline is sourced from PubChem (CID 571906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).