About buta-1,3-diene;ethane;4-octylaniline
buta-1,3-diene;ethane;4-octylaniline (PubChem CID 143848294) has the molecular formula C20H35N
and a molecular weight of 289.51 g/mol. Its IUPAC name is buta-1,3-diene;ethane;4-octylaniline.
Molecular Properties
| Compound Name | buta-1,3-diene;ethane;4-octylaniline |
| PubChem CID | 143848294 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | buta-1,3-diene;ethane;4-octylaniline |
| SMILES | C=CC=C.CC.CCCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C14H23N.C4H6.C2H6/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;1-3-4-2;1-2/h9-12H,2-8,15H2,1H3;3-4H,1-2H2;1-2H3 |
| InChIKey | PCMXNECQDFLWGO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;ethane;4-octylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;ethane;4-octylaniline?
The IUPAC name of buta-1,3-diene;ethane;4-octylaniline (CID 143848294) is buta-1,3-diene;ethane;4-octylaniline.
What is the SMILES notation for buta-1,3-diene;ethane;4-octylaniline?
The canonical SMILES for buta-1,3-diene;ethane;4-octylaniline is C=CC=C.CC.CCCCCCCCc1ccc(N)cc1.
What is the InChIKey of buta-1,3-diene;ethane;4-octylaniline?
The InChIKey is PCMXNECQDFLWGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N.C4H6.C2H6/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;1-3-4-2;1-2/h9-12H,2-8,15H2,1H3;3-4H,1-2H2;1-2H3.
What are the key properties of buta-1,3-diene;ethane;4-octylaniline?
buta-1,3-diene;ethane;4-octylaniline has a molecular weight of 289.51 g/mol, XLogP of 6.56, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;ethane;4-octylaniline is sourced from PubChem (CID 143848294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).