C19H31N — CID 143848272
4-octylaniline;(3E)-penta-1,3-diene (PubChem CID 143848272) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 4-octylaniline;(3E)-penta-1,3-diene.
| Compound Name | 4-octylaniline;(3E)-penta-1,3-diene |
|---|---|
| PubChem CID | 143848272 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 4-octylaniline;(3E)-penta-1,3-diene |
| SMILES | C=C/C=C/C.CCCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C14H23N.C5H8/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13;1-3-5-4-2/h9-12H,2-8,15H2,1H3;3-5H,1H2,2H3/b;5-4+ |
| InChIKey | XLVIFESVEBCIBS-RCKHEGBHSA-N |
| XLogP | 5.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|