About 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene
1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene (PubChem CID 22646096) has the molecular formula C33H50
and a molecular weight of 446.76 g/mol. Its IUPAC name is 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene |
| PubChem CID | 22646096 |
| Molecular Formula | C33H50 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.39 |
| IUPAC Name | 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene |
| SMILES | C=Cc1ccc(CCCCCCCC)cc1.C=Cc1ccc(CCCCCCCCC)cc1 |
| InChI | InChI=1S/C17H26.C16H24/c1-3-5-6-7-8-9-10-11-17-14-12-16(4-2)13-15-17;1-3-5-6-7-8-9-10-16-13-11-15(4-2)12-14-16/h4,12-15H,2-3,5-11H2,1H3;4,11-14H,2-3,5-10H2,1H3 |
| InChIKey | SWEAVOWYQGIKEY-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene?
The IUPAC name of 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene (CID 22646096) is 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene.
What is the SMILES notation for 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene?
The canonical SMILES for 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene is C=Cc1ccc(CCCCCCCC)cc1.C=Cc1ccc(CCCCCCCCC)cc1.
What is the InChIKey of 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene?
The InChIKey is SWEAVOWYQGIKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26.C16H24/c1-3-5-6-7-8-9-10-11-17-14-12-16(4-2)13-15-17;1-3-5-6-7-8-9-10-16-13-11-15(4-2)12-14-16/h4,12-15H,2-3,5-11H2,1H3;4,11-14H,2-3,5-10H2,1H3.
What are the key properties of 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene?
1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene has a molecular weight of 446.76 g/mol, XLogP of 10.86, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-nonylbenzene;1-ethenyl-4-octylbenzene is sourced from PubChem (CID 22646096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).