About 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene
1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene (PubChem CID 157182704) has the molecular formula C24H32O
and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene |
| PubChem CID | 157182704 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene |
| SMILES | C=Cc1ccc(CCCCCC)cc1.C=Cc1ccc(COC)cc1 |
| InChI | InChI=1S/C14H20.C10H12O/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-3-9-4-6-10(7-5-9)8-11-2/h4,9-12H,2-3,5-8H2,1H3;3-7H,1,8H2,2H3 |
| InChIKey | AOTCPXGMHCCWEP-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene?
The IUPAC name of 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene (CID 157182704) is 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene.
What is the SMILES notation for 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene?
The canonical SMILES for 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene is C=Cc1ccc(CCCCCC)cc1.C=Cc1ccc(COC)cc1.
What is the InChIKey of 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene?
The InChIKey is AOTCPXGMHCCWEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.C10H12O/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-3-9-4-6-10(7-5-9)8-11-2/h4,9-12H,2-3,5-8H2,1H3;3-7H,1,8H2,2H3.
What are the key properties of 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene?
1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene has a molecular weight of 336.52 g/mol, XLogP of 6.93, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-hexylbenzene;1-ethenyl-4-(methoxymethyl)benzene is sourced from PubChem (CID 157182704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).