C19H20F4 — CID 90876868
1-ethenyl-4-pentylbenzene;1,2,3,5-tetrafluorobenzene (PubChem CID 90876868) has the molecular formula C19H20F4 and a molecular weight of 324.36 g/mol. Its IUPAC name is 1-ethenyl-4-pentylbenzene;1,2,3,5-tetrafluorobenzene.
| Compound Name | 1-ethenyl-4-pentylbenzene;1,2,3,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 90876868 |
| Molecular Formula | C19H20F4 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-ethenyl-4-pentylbenzene;1,2,3,5-tetrafluorobenzene |
| SMILES | C=Cc1ccc(CCCCC)cc1.Fc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H18.C6H2F4/c1-3-5-6-7-13-10-8-12(4-2)9-11-13;7-3-1-4(8)6(10)5(9)2-3/h4,8-11H,2-3,5-7H2,1H3;1-2H |
| InChIKey | QYXKWIMOKRZDRC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|