C21H21F3S — CID 154256554
1-(4-hexylphenyl)-3-(2,3,5-trifluorophenyl)prop-2-ene-1-thione (PubChem CID 154256554) has the molecular formula C21H21F3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-(4-hexylphenyl)-3-(2,3,5-trifluorophenyl)prop-2-ene-1-thione.
| Compound Name | 1-(4-hexylphenyl)-3-(2,3,5-trifluorophenyl)prop-2-ene-1-thione |
|---|---|
| PubChem CID | 154256554 |
| Molecular Formula | C21H21F3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(4-hexylphenyl)-3-(2,3,5-trifluorophenyl)prop-2-ene-1-thione |
| SMILES | CCCCCCc1ccc(C(=S)C=Cc2cc(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C21H21F3S/c1-2-3-4-5-6-15-7-9-16(10-8-15)20(25)12-11-17-13-18(22)14-19(23)21(17)24/h7-14H,2-6H2,1H3 |
| InChIKey | OFJUBYFRFBZTAI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|