C34H50O2S — CID 54056106
3-(3,5-dioctoxyphenyl)-1-(4-propylphenyl)prop-2-ene-1-thione (PubChem CID 54056106) has the molecular formula C34H50O2S and a molecular weight of 522.84 g/mol. Its IUPAC name is 3-(3,5-dioctoxyphenyl)-1-(4-propylphenyl)prop-2-ene-1-thione.
| Compound Name | 3-(3,5-dioctoxyphenyl)-1-(4-propylphenyl)prop-2-ene-1-thione |
|---|---|
| PubChem CID | 54056106 |
| Molecular Formula | C34H50O2S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 3-(3,5-dioctoxyphenyl)-1-(4-propylphenyl)prop-2-ene-1-thione |
| SMILES | CCCCCCCCOc1cc(C=CC(=S)c2ccc(CCC)cc2)cc(OCCCCCCCC)c1 |
| InChI | InChI=1S/C34H50O2S/c1-4-7-9-11-13-15-24-35-32-26-30(27-33(28-32)36-25-16-14-12-10-8-5-2)20-23-34(37)31-21-18-29(17-6-3)19-22-31/h18-23,26-28H,4-17,24-25H2,1-3H3 |
| InChIKey | LWJHCCXPGINJMO-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|