C36H54O3S — CID 19824539
(E)-3-[3,5-di(nonoxy)phenyl]-1-(4-propylsulfanylphenyl)prop-2-en-1-one (PubChem CID 19824539) has the molecular formula C36H54O3S and a molecular weight of 566.89 g/mol. Its IUPAC name is (E)-3-[3,5-di(nonoxy)phenyl]-1-(4-propylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3,5-di(nonoxy)phenyl]-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19824539 |
| Molecular Formula | C36H54O3S |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | (E)-3-[3,5-di(nonoxy)phenyl]-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCCCOc1cc(/C=C/C(=O)c2ccc(SCCC)cc2)cc(OCCCCCCCCC)c1 |
| InChI | InChI=1S/C36H54O3S/c1-4-7-9-11-13-15-17-25-38-33-28-31(29-34(30-33)39-26-18-16-14-12-10-8-5-2)19-24-36(37)32-20-22-35(23-21-32)40-27-6-3/h19-24,28-30H,4-18,25-27H2,1-3H3/b24-19+ |
| InChIKey | GCQGBZHRDWCIKG-LYBHJNIJSA-N |
| XLogP | 11.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|