C21H24O2S — CID 67829039
3-(3-propoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one (PubChem CID 67829039) has the molecular formula C21H24O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-(3-propoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-propoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 67829039 |
| Molecular Formula | C21H24O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-(3-propoxyphenyl)-1-(4-propylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCCOc1cccc(C=CC(=O)c2ccc(SCCC)cc2)c1 |
| InChI | InChI=1S/C21H24O2S/c1-3-14-23-19-7-5-6-17(16-19)8-13-21(22)18-9-11-20(12-10-18)24-15-4-2/h5-13,16H,3-4,14-15H2,1-2H3 |
| InChIKey | BGQQVCKPWCZGKM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|