C27H36O4S — CID 19824741
(E)-1-(4-propylsulfanylphenyl)-3-(3,4,5-tripropoxyphenyl)prop-2-en-1-one (PubChem CID 19824741) has the molecular formula C27H36O4S and a molecular weight of 456.65 g/mol. Its IUPAC name is (E)-1-(4-propylsulfanylphenyl)-3-(3,4,5-tripropoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-propylsulfanylphenyl)-3-(3,4,5-tripropoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19824741 |
| Molecular Formula | C27H36O4S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (E)-1-(4-propylsulfanylphenyl)-3-(3,4,5-tripropoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1cc(/C=C/C(=O)c2ccc(SCCC)cc2)cc(OCCC)c1OCCC |
| InChI | InChI=1S/C27H36O4S/c1-5-15-29-25-19-21(20-26(30-16-6-2)27(25)31-17-7-3)9-14-24(28)22-10-12-23(13-11-22)32-18-8-4/h9-14,19-20H,5-8,15-18H2,1-4H3/b14-9+ |
| InChIKey | PBULPNGIBQBWPO-NTEUORMPSA-N |
| XLogP | 7.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|