C33H48N4O8 — CID 160746147
(1E,6E)-1,7-bis[3,4-bis(2-aminoethoxy)-5-propoxyphenyl]hepta-1,6-diene-3,5-dione (PubChem CID 160746147) has the molecular formula C33H48N4O8 and a molecular weight of 628.77 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[3,4-bis(2-aminoethoxy)-5-propoxyphenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[3,4-bis(2-aminoethoxy)-5-propoxyphenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 160746147 |
| Molecular Formula | C33H48N4O8 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | (1E,6E)-1,7-bis[3,4-bis(2-aminoethoxy)-5-propoxyphenyl]hepta-1,6-diene-3,5-dione |
| SMILES | CCCOc1cc(/C=C/C(=O)CC(=O)/C=C/c2cc(OCCC)c(OCCN)c(OCCN)c2)cc(OCCN)c1OCCN |
| InChI | InChI=1S/C33H48N4O8/c1-3-13-40-28-19-24(21-30(42-15-9-34)32(28)44-17-11-36)5-7-26(38)23-27(39)8-6-25-20-29(41-14-4-2)33(45-18-12-37)31(22-25)43-16-10-35/h5-8,19-22H,3-4,9-18,23,34-37H2,1-2H3/b7-5+,8-6+ |
| InChIKey | UEBCUGNWLODIBI-KQQUZDAGSA-N |
| XLogP | 2.87 |
| TPSA | 193.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|