C23H29BrO3 — CID 640261
5-[(E)-2-(4-bromophenyl)ethenyl]-1,2,3-tripropoxybenzene (PubChem CID 640261) has the molecular formula C23H29BrO3 and a molecular weight of 433.39 g/mol. Its IUPAC name is 5-[(E)-2-(4-bromophenyl)ethenyl]-1,2,3-tripropoxybenzene.
| Compound Name | 5-[(E)-2-(4-bromophenyl)ethenyl]-1,2,3-tripropoxybenzene |
|---|---|
| PubChem CID | 640261 |
| Molecular Formula | C23H29BrO3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 5-[(E)-2-(4-bromophenyl)ethenyl]-1,2,3-tripropoxybenzene |
| SMILES | CCCOc1cc(/C=C/c2ccc(Br)cc2)cc(OCCC)c1OCCC |
| InChI | InChI=1S/C23H29BrO3/c1-4-13-25-21-16-19(8-7-18-9-11-20(24)12-10-18)17-22(26-14-5-2)23(21)27-15-6-3/h7-12,16-17H,4-6,13-15H2,1-3H3/b8-7+ |
| InChIKey | QZJXJPABPCTGSY-BQYQJAHWSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|