C32H48O5 — CID 10815635
5-[(E)-2-(3,4,5-trihexoxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 10815635) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is 5-[(E)-2-(3,4,5-trihexoxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(3,4,5-trihexoxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 10815635 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | 5-[(E)-2-(3,4,5-trihexoxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | CCCCCCOc1cc(/C=C/c2cc(O)cc(O)c2)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C32H48O5/c1-4-7-10-13-18-35-30-23-27(17-16-26-21-28(33)25-29(34)22-26)24-31(36-19-14-11-8-5-2)32(30)37-20-15-12-9-6-3/h16-17,21-25,33-34H,4-15,18-20H2,1-3H3/b17-16+ |
| InChIKey | OXPCACRNIMCARY-WUKNDPDISA-N |
| XLogP | 9.15 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|