C25H42O4 — CID 15316903
3,4,5-trihexoxybenzaldehyde (PubChem CID 15316903) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3,4,5-trihexoxybenzaldehyde.
| Compound Name | 3,4,5-trihexoxybenzaldehyde |
|---|---|
| PubChem CID | 15316903 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 3,4,5-trihexoxybenzaldehyde |
| SMILES | CCCCCCOc1cc(C=O)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C25H42O4/c1-4-7-10-13-16-27-23-19-22(21-26)20-24(28-17-14-11-8-5-2)25(23)29-18-15-12-9-6-3/h19-21H,4-18H2,1-3H3 |
| InChIKey | XYCUVMLGUDIETM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|