C52H64O8 — CID 11498767
25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbaldehyde (PubChem CID 11498767) has the molecular formula C52H64O8 and a molecular weight of 817.08 g/mol. Its IUPAC name is 25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbaldehyde.
| Compound Name | 25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbaldehyde |
|---|---|
| PubChem CID | 11498767 |
| Molecular Formula | C52H64O8 |
| Molecular Weight | 817.08 g/mol |
| Exact Mass | 816.46 |
| IUPAC Name | 25,26,27,28-tetrapentoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetracarbaldehyde |
| SMILES | CCCCCOc1c2cc(C=O)cc1Cc1cc(C=O)cc(c1OCCCCC)Cc1cc(C=O)cc(c1OCCCCC)Cc1cc(C=O)cc(c1OCCCCC)C2 |
| InChI | InChI=1S/C52H64O8/c1-5-9-13-17-57-49-41-21-37(33-53)22-42(49)30-44-24-39(35-55)26-46(51(44)59-19-15-11-7-3)32-48-28-40(36-56)27-47(52(48)60-20-16-12-8-4)31-45-25-38(34-54)23-43(29-41)50(45)58-18-14-10-6-2/h21-28,33-36H,5-20,29-32H2,1-4H3 |
| InChIKey | QUXHONDHFSFNQU-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.08 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|