C11H12F2O2 — CID 79018256
4-butoxy-3,5-difluorobenzaldehyde (PubChem CID 79018256) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 4-butoxy-3,5-difluorobenzaldehyde.
| Compound Name | 4-butoxy-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 79018256 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-butoxy-3,5-difluorobenzaldehyde |
| SMILES | CCCCOc1c(F)cc(C=O)cc1F |
| InChI | InChI=1S/C11H12F2O2/c1-2-3-4-15-11-9(12)5-8(7-14)6-10(11)13/h5-7H,2-4H2,1H3 |
| InChIKey | ZMCWTXCZMRLOTD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|