C13H16F2O2 — CID 91657786
3,5-difluoro-2-hexoxybenzaldehyde (PubChem CID 91657786) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 3,5-difluoro-2-hexoxybenzaldehyde.
| Compound Name | 3,5-difluoro-2-hexoxybenzaldehyde |
|---|---|
| PubChem CID | 91657786 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3,5-difluoro-2-hexoxybenzaldehyde |
| SMILES | CCCCCCOc1c(F)cc(F)cc1C=O |
| InChI | InChI=1S/C13H16F2O2/c1-2-3-4-5-6-17-13-10(9-16)7-11(14)8-12(13)15/h7-9H,2-6H2,1H3 |
| InChIKey | XQAHLACIPVNOKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|