C102H138F12O6 — CID 101373438
1,2,3,4,5,6-hexakis(4-decoxy-3,5-difluorophenyl)benzene (PubChem CID 101373438) has the molecular formula C102H138F12O6 and a molecular weight of 1688.20 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(4-decoxy-3,5-difluorophenyl)benzene.
| Compound Name | 1,2,3,4,5,6-hexakis(4-decoxy-3,5-difluorophenyl)benzene |
|---|---|
| PubChem CID | 101373438 |
| Molecular Formula | C102H138F12O6 |
| Molecular Weight | 1688.20 g/mol |
| Exact Mass | 1687.03 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(4-decoxy-3,5-difluorophenyl)benzene |
| SMILES | CCCCCCCCCCOc1c(F)cc(-c2c(-c3cc(F)c(OCCCCCCCCCC)c(F)c3)c(-c3cc(F)c(OCCCCCCCCCC)c(F)c3)c(-c3cc(F)c(OCCCCCCCCCC)c(F)c3)c(-c3cc(F)c(OCCCCCCCCCC)c(F)c3)c2-c2cc(F)c(OCCCCCCCCCC)c(F)c2)cc1F |
| InChI | InChI=1S/C102H138F12O6/c1-7-13-19-25-31-37-43-49-55-115-97-79(103)61-73(62-80(97)104)91-92(74-63-81(105)98(82(106)64-74)116-56-50-44-38-32-26-20-14-8-2)94(76-67-85(109)100(86(110)68-76)118-58-52-46-40-34-28-22-16-10-4)96(78-71-89(113)102(90(114)72-78)120-60-54-48-42-36-30-24-18-12-6)95(77-69-87(111)101(88(112)70-77)119-59-53-47-41-35-29-23-17-11-5)93(91)75-65-83(107)99(84(108)66-75)117-57-51-45-39-33-27-21-15-9-3/h61-72H,7-60H2,1-6H3 |
| InChIKey | GIJVGEVSUGMJNA-UHFFFAOYSA-N |
| XLogP | 34.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 120 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1688.20 |
| LogP ≤ 5 | 34.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|