C20H24F2O — CID 15176798
1,3-difluoro-2-octoxy-5-phenylbenzene (PubChem CID 15176798) has the molecular formula C20H24F2O and a molecular weight of 318.41 g/mol. Its IUPAC name is 1,3-difluoro-2-octoxy-5-phenylbenzene.
| Compound Name | 1,3-difluoro-2-octoxy-5-phenylbenzene |
|---|---|
| PubChem CID | 15176798 |
| Molecular Formula | C20H24F2O |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1,3-difluoro-2-octoxy-5-phenylbenzene |
| SMILES | CCCCCCCCOc1c(F)cc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C20H24F2O/c1-2-3-4-5-6-10-13-23-20-18(21)14-17(15-19(20)22)16-11-8-7-9-12-16/h7-9,11-12,14-15H,2-6,10,13H2,1H3 |
| InChIKey | ZRQHTTFMLORUNK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|