C17H25BrF2O — CID 79881356
5-(bromomethyl)-2-decoxy-1,3-difluorobenzene (PubChem CID 79881356) has the molecular formula C17H25BrF2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 5-(bromomethyl)-2-decoxy-1,3-difluorobenzene.
| Compound Name | 5-(bromomethyl)-2-decoxy-1,3-difluorobenzene |
|---|---|
| PubChem CID | 79881356 |
| Molecular Formula | C17H25BrF2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-(bromomethyl)-2-decoxy-1,3-difluorobenzene |
| SMILES | CCCCCCCCCCOc1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C17H25BrF2O/c1-2-3-4-5-6-7-8-9-10-21-17-15(19)11-14(13-18)12-16(17)20/h11-12H,2-10,13H2,1H3 |
| InChIKey | RLHWCOWVGBZSJT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|