C13H17BrF2O — CID 79887890
5-(bromomethyl)-1,3-difluoro-2-hexoxybenzene (PubChem CID 79887890) has the molecular formula C13H17BrF2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-difluoro-2-hexoxybenzene.
| Compound Name | 5-(bromomethyl)-1,3-difluoro-2-hexoxybenzene |
|---|---|
| PubChem CID | 79887890 |
| Molecular Formula | C13H17BrF2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-(bromomethyl)-1,3-difluoro-2-hexoxybenzene |
| SMILES | CCCCCCOc1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C13H17BrF2O/c1-2-3-4-5-6-17-13-11(15)7-10(9-14)8-12(13)16/h7-8H,2-6,9H2,1H3 |
| InChIKey | KFOBLKBWWAUQIF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|