C12H15BrF2O3S — CID 79888367
5-(bromomethyl)-2-(3-ethylsulfonylpropoxy)-1,3-difluorobenzene (PubChem CID 79888367) has the molecular formula C12H15BrF2O3S and a molecular weight of 357.22 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(3-ethylsulfonylpropoxy)-1,3-difluorobenzene.
| Compound Name | 5-(bromomethyl)-2-(3-ethylsulfonylpropoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 79888367 |
| Molecular Formula | C12H15BrF2O3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 5-(bromomethyl)-2-(3-ethylsulfonylpropoxy)-1,3-difluorobenzene |
| SMILES | CCS(=O)(=O)CCCOc1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C12H15BrF2O3S/c1-2-19(16,17)5-3-4-18-12-10(14)6-9(8-13)7-11(12)15/h6-7H,2-5,8H2,1H3 |
| InChIKey | YMNCLTPJTROMLJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|