C14H21F2NO3S — CID 79882804
1-[3,5-difluoro-4-(3-methylsulfonylpropoxy)phenyl]butan-2-amine (PubChem CID 79882804) has the molecular formula C14H21F2NO3S and a molecular weight of 321.39 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(3-methylsulfonylpropoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3,5-difluoro-4-(3-methylsulfonylpropoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 79882804 |
| Molecular Formula | C14H21F2NO3S |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[3,5-difluoro-4-(3-methylsulfonylpropoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(F)c(OCCCS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C14H21F2NO3S/c1-3-11(17)7-10-8-12(15)14(13(16)9-10)20-5-4-6-21(2,18)19/h8-9,11H,3-7,17H2,1-2H3 |
| InChIKey | WMIUKLPMCGXFSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|