C11H13Br3O3S — CID 107745698
1,3-dibromo-5-(bromomethyl)-2-(3-methylsulfonylpropoxy)benzene (PubChem CID 107745698) has the molecular formula C11H13Br3O3S and a molecular weight of 465.00 g/mol. Its IUPAC name is 1,3-dibromo-5-(bromomethyl)-2-(3-methylsulfonylpropoxy)benzene.
| Compound Name | 1,3-dibromo-5-(bromomethyl)-2-(3-methylsulfonylpropoxy)benzene |
|---|---|
| PubChem CID | 107745698 |
| Molecular Formula | C11H13Br3O3S |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 461.81 |
| IUPAC Name | 1,3-dibromo-5-(bromomethyl)-2-(3-methylsulfonylpropoxy)benzene |
| SMILES | CS(=O)(=O)CCCOc1c(Br)cc(CBr)cc1Br |
| InChI | InChI=1S/C11H13Br3O3S/c1-18(15,16)4-2-3-17-11-9(13)5-8(7-12)6-10(11)14/h5-6H,2-4,7H2,1H3 |
| InChIKey | BZWMVZQDOIZRLV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|