C12H15Br2ClO3S — CID 107745574
1,3-dibromo-5-(chloromethyl)-2-(2-propylsulfonylethoxy)benzene (PubChem CID 107745574) has the molecular formula C12H15Br2ClO3S and a molecular weight of 434.58 g/mol. Its IUPAC name is 1,3-dibromo-5-(chloromethyl)-2-(2-propylsulfonylethoxy)benzene.
| Compound Name | 1,3-dibromo-5-(chloromethyl)-2-(2-propylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 107745574 |
| Molecular Formula | C12H15Br2ClO3S |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 1,3-dibromo-5-(chloromethyl)-2-(2-propylsulfonylethoxy)benzene |
| SMILES | CCCS(=O)(=O)CCOc1c(Br)cc(CCl)cc1Br |
| InChI | InChI=1S/C12H15Br2ClO3S/c1-2-4-19(16,17)5-3-18-12-10(13)6-9(8-15)7-11(12)14/h6-7H,2-5,8H2,1H3 |
| InChIKey | MVSHREIWLQWQIO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|