C14H21ClO3S — CID 106726480
5-(chloromethyl)-1,3-dimethyl-2-(2-propylsulfonylethoxy)benzene (PubChem CID 106726480) has the molecular formula C14H21ClO3S and a molecular weight of 304.84 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-2-(2-propylsulfonylethoxy)benzene.
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-2-(2-propylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 106726480 |
| Molecular Formula | C14H21ClO3S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-2-(2-propylsulfonylethoxy)benzene |
| SMILES | CCCS(=O)(=O)CCOc1c(C)cc(CCl)cc1C |
| InChI | InChI=1S/C14H21ClO3S/c1-4-6-19(16,17)7-5-18-14-11(2)8-13(10-15)9-12(14)3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | HDZSLMNISIVCAR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|