C15H23ClO2 — CID 54956349
2-(2-butoxyethoxy)-5-(chloromethyl)-1,3-dimethylbenzene (PubChem CID 54956349) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-5-(chloromethyl)-1,3-dimethylbenzene.
| Compound Name | 2-(2-butoxyethoxy)-5-(chloromethyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 54956349 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(2-butoxyethoxy)-5-(chloromethyl)-1,3-dimethylbenzene |
| SMILES | CCCCOCCOc1c(C)cc(CCl)cc1C |
| InChI | InChI=1S/C15H23ClO2/c1-4-5-6-17-7-8-18-15-12(2)9-14(11-16)10-13(15)3/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | UOHWQBDVCCQBCG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|