C16H26O2 — CID 43129630
(4-heptoxy-3,5-dimethylphenyl)methanol (PubChem CID 43129630) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4-heptoxy-3,5-dimethylphenyl)methanol.
| Compound Name | (4-heptoxy-3,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 43129630 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4-heptoxy-3,5-dimethylphenyl)methanol |
| SMILES | CCCCCCCOc1c(C)cc(CO)cc1C |
| InChI | InChI=1S/C16H26O2/c1-4-5-6-7-8-9-18-16-13(2)10-15(12-17)11-14(16)3/h10-11,17H,4-9,12H2,1-3H3 |
| InChIKey | POFXMFQRNAKNCD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|