C17H29NO — CID 63420985
1-(4-hexoxy-3,5-dimethylphenyl)propan-2-amine (PubChem CID 63420985) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-(4-hexoxy-3,5-dimethylphenyl)propan-2-amine.
| Compound Name | 1-(4-hexoxy-3,5-dimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 63420985 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(4-hexoxy-3,5-dimethylphenyl)propan-2-amine |
| SMILES | CCCCCCOc1c(C)cc(CC(C)N)cc1C |
| InChI | InChI=1S/C17H29NO/c1-5-6-7-8-9-19-17-13(2)10-16(11-14(17)3)12-15(4)18/h10-11,15H,5-9,12,18H2,1-4H3 |
| InChIKey | PSYDNPBZMMVDPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|