C16H25NO3 — CID 60908291
methyl 4-[4-(2-aminopropyl)-2,6-dimethylphenoxy]butanoate (PubChem CID 60908291) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 4-[4-(2-aminopropyl)-2,6-dimethylphenoxy]butanoate.
| Compound Name | methyl 4-[4-(2-aminopropyl)-2,6-dimethylphenoxy]butanoate |
|---|---|
| PubChem CID | 60908291 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | methyl 4-[4-(2-aminopropyl)-2,6-dimethylphenoxy]butanoate |
| SMILES | COC(=O)CCCOc1c(C)cc(CC(C)N)cc1C |
| InChI | InChI=1S/C16H25NO3/c1-11-8-14(10-13(3)17)9-12(2)16(11)20-7-5-6-15(18)19-4/h8-9,13H,5-7,10,17H2,1-4H3 |
| InChIKey | JSAGWFWAPGVFKE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|