C15H23NO — CID 54930474
1-[3,5-dimethyl-4-(2-methylprop-2-enoxy)phenyl]propan-2-amine (PubChem CID 54930474) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-(2-methylprop-2-enoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3,5-dimethyl-4-(2-methylprop-2-enoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 54930474 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[3,5-dimethyl-4-(2-methylprop-2-enoxy)phenyl]propan-2-amine |
| SMILES | C=C(C)COc1c(C)cc(CC(C)N)cc1C |
| InChI | InChI=1S/C15H23NO/c1-10(2)9-17-15-11(3)6-14(7-12(15)4)8-13(5)16/h6-7,13H,1,8-9,16H2,2-5H3 |
| InChIKey | IGIGJXQGLRLJCS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|