C10H15NO2 — CID 89349116
5-[(2R)-2-aminopropyl]-3-methylbenzene-1,2-diol (PubChem CID 89349116) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-[(2R)-2-aminopropyl]-3-methylbenzene-1,2-diol.
| Compound Name | 5-[(2R)-2-aminopropyl]-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 89349116 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5-[(2R)-2-aminopropyl]-3-methylbenzene-1,2-diol |
| SMILES | Cc1cc(C[C@@H](C)N)cc(O)c1O |
| InChI | InChI=1S/C10H15NO2/c1-6-3-8(4-7(2)11)5-9(12)10(6)13/h3,5,7,12-13H,4,11H2,1-2H3/t7-/m1/s1 |
| InChIKey | OBDVULWHJGZQFC-SSDOTTSWSA-N |
| XLogP | 1.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|