C11H19NO2 — CID 169229376
4-(2-aminopropyl)benzene-1,2-diol;ethane (PubChem CID 169229376) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-(2-aminopropyl)benzene-1,2-diol;ethane.
| Compound Name | 4-(2-aminopropyl)benzene-1,2-diol;ethane |
|---|---|
| PubChem CID | 169229376 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-(2-aminopropyl)benzene-1,2-diol;ethane |
| SMILES | CC.CC(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO2.C2H6/c1-6(10)4-7-2-3-8(11)9(12)5-7;1-2/h2-3,5-6,11-12H,4,10H2,1H3;1-2H3 |
| InChIKey | OEBANXUTOJWXDA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|