C8H12BrNO3 — CID 69301121
4-(2-amino-2-hydroxyethyl)benzene-1,2-diol;hydrobromide (PubChem CID 69301121) has the molecular formula C8H12BrNO3 and a molecular weight of 250.09 g/mol. Its IUPAC name is 4-(2-amino-2-hydroxyethyl)benzene-1,2-diol;hydrobromide.
| Compound Name | 4-(2-amino-2-hydroxyethyl)benzene-1,2-diol;hydrobromide |
|---|---|
| PubChem CID | 69301121 |
| Molecular Formula | C8H12BrNO3 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 4-(2-amino-2-hydroxyethyl)benzene-1,2-diol;hydrobromide |
| SMILES | Br.NC(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3.BrH/c9-8(12)4-5-1-2-6(10)7(11)3-5;/h1-3,8,10-12H,4,9H2;1H |
| InChIKey | XPDWEEOUGRZNSY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|