2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid

C9H11NO4 — CID 102602062

IUPAC2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid
SMILESNC(Cc1ccc(O)c(O)c1)[14C](=O)O
InChIInChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/i9+2
InChIKeyWTDRDQBEARUVNC-FOQJRBATSA-N
MW199.18 g/mol
LogP0.05
Rot. Bonds3

About 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid

2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid (PubChem CID 102602062) has the molecular formula C9H11NO4 and a molecular weight of 199.18 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid
PubChem CID102602062
Molecular FormulaC9H11NO4
Molecular Weight199.18 g/mol
Exact Mass199.07
IUPAC Name2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid
SMILESNC(Cc1ccc(O)c(O)c1)[14C](=O)O
InChIInChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/i9+2
InChIKeyWTDRDQBEARUVNC-FOQJRBATSA-N
XLogP0.05
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.18
LogP ≤ 50.05
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid?
The IUPAC name of 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid (CID 102602062) is 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid.
What is the SMILES notation for 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid?
The canonical SMILES for 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid is NC(Cc1ccc(O)c(O)c1)[14C](=O)O.
What is the InChIKey of 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid?
The InChIKey is WTDRDQBEARUVNC-FOQJRBATSA-N. The full InChI is InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/i9+2.
What are the key properties of 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid?
2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid has a molecular weight of 199.18 g/mol, XLogP of 0.05, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3,4-dihydroxyphenyl)(114C)propanoic acid is sourced from PubChem (CID 102602062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).