C8H10BF3NO2- — CID 159192961
[1-amino-2-(3,4-dihydroxyphenyl)ethyl]-trifluoroboranuide (PubChem CID 159192961) has the molecular formula C8H10BF3NO2- and a molecular weight of 219.98 g/mol. Its IUPAC name is [1-amino-2-(3,4-dihydroxyphenyl)ethyl]-trifluoroboranuide.
| Compound Name | [1-amino-2-(3,4-dihydroxyphenyl)ethyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 159192961 |
| Molecular Formula | C8H10BF3NO2- |
| Molecular Weight | 219.98 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [1-amino-2-(3,4-dihydroxyphenyl)ethyl]-trifluoroboranuide |
| SMILES | NC(Cc1ccc(O)c(O)c1)[B-](F)(F)F |
| InChI | InChI=1S/C8H10BF3NO2/c10-9(11,12)8(13)4-5-1-2-6(14)7(15)3-5/h1-3,8,14-15H,4,13H2/q-1 |
| InChIKey | MPKBVAJEOVBXRV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.98 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|