C13H20N2O4 — CID 64912248
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(3-hydroxybutyl)propanamide (PubChem CID 64912248) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(3-hydroxybutyl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(3-hydroxybutyl)propanamide |
|---|---|
| PubChem CID | 64912248 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(3-hydroxybutyl)propanamide |
| SMILES | CC(O)CCNC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-8(16)4-5-15-13(19)10(14)6-9-2-3-11(17)12(18)7-9/h2-3,7-8,10,16-18H,4-6,14H2,1H3,(H,15,19)/t8?,10-/m0/s1 |
| InChIKey | WMQDOVIOGCIIEQ-HTLJXXAVSA-N |
| XLogP | -0.15 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|