C12H19N3O3 — CID 61275867
(2S)-2-amino-N-(3-aminopropyl)-3-(3,4-dihydroxyphenyl)propanamide (PubChem CID 61275867) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-aminopropyl)-3-(3,4-dihydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(3-aminopropyl)-3-(3,4-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 61275867 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | (2S)-2-amino-N-(3-aminopropyl)-3-(3,4-dihydroxyphenyl)propanamide |
| SMILES | NCCCNC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H19N3O3/c13-4-1-5-15-12(18)9(14)6-8-2-3-10(16)11(17)7-8/h2-3,7,9,16-17H,1,4-6,13-14H2,(H,15,18)/t9-/m0/s1 |
| InChIKey | ZJEWLGWSNWIHAS-VIFPVBQESA-N |
| XLogP | -0.57 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|